microbik.ru
1
3 Материалы коллоквиумов

3.1 Вопросы коллоквиумов

Вопросы к I коллоквиуму ПР

1.Основные понятия по химии. Стехиометрические законы.

2. Закон эквивалентов, фактор эквивалентности, определение молярной массы химического эквивалента простых и сложных веществ.

3.Строение атомов. элементов малых и больших периодов.

4.Атомные орбитали для s-, p-, d- состояний электронов. Многоэлектронные атомы.

5. Принцип Паули. Максимальное число электронов в электронных слоях и оболочках. 6.Правило Гунда. Последовательность энергетических уровней и подуровней электронов в многоэлектронных атомах. Магнитные и энергетические характеристики атомов.

7. Энергия ионизации, сродство к электрону.

8. Заполнение электронных слоев и оболочек атомов. Правило Клечковского.

9.Ковалентная связь. Метод валентных связей. Электроотрицательность. Свойства ковалентной связи, направленность и насыщаемость. Полярная ковалентная связь. 10.Механизм образования ковалентной связи (обменный, донорно-акцепторный механизм). Характеристика ковалентной связи: длина, прочность, валентные углы.

11.Основные положения метода валентных связей. Валентность элемента.

12.Ионная связь, как предельный случай ковалентной связи не направленность и не насыщенность ионной связи. Электростатическое взаимодействие ионов.

13.Типы кристаллических решеток (атомная, молекулярная, ионная, металлическая). Природа связи между частицами в различных типах кристаллических решеток. 14.Металлическая связь. Свойства металлов обусловленные металлической связью. Сходство и различие металлической связи с ковалентной и ионной.

Вопросы коллоквиума (II) ПР

1. Способы выражения концентрации растворов.

2..Законы Рауля.Кипение и отвердение растворов. Осмотическое давление.

3.Гидролиз солей. Усиление и подавление гидролиза.

4.Окислительно-восстановительные реакции.Важнейшие окислители и восстановители.

5.Составление уравнений реакций окисления-восстановления. Влияние среды на характер реакций.

6. Электрохимические процессы. Понятие об электродных потенциалах. Стандартные электродные потенциалы, строение двойного электрического слоя на границе электрод-раствор.

7.Уравнение Нернста. Гальванические элементы. ЭДС гальванических элементов.

8. Электролиз. Окислительно-восстановительные процессы при электролизе.

9.Закон Фарадея. Электролиз с нерастворимыми и растворимыми анодами. Применение электролиза для лужения жести и регенерации олова из отходов.

10. Коррозия металлов. Виды коррозии, ущерб от нее.

11.Основные методы защиты от коррозии: легирование, электрохимическая защита, защитные покрытия

3.2 Варианты коллоквиумов
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ
Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант1

  1. Эквивалент, закон эквивалентов, эквивалентная масса, эквивалентный объем.

  2. Определите валентность в нормальном и возбужденном состоянии № 37 (показать схему, формулу, охарактеризовать квантовые числа последнего уровня).

  3. Определите степень окисления углерода в соединениях HCOOH,CH3OH




  1. Докажите угловое строение H2O, CH4 (показать схемой)




  1. Определите фактор эквивалентности и молярную массу химического эквивалента исходных веществ:

NaHSO4 + NaCl= Na2SO4 + HCl
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант 2


  1. Правило Клечковского, какой из подуровней заполняется первый 4d и 3f.

2.Определить валентность в нормальном и возбужденном состоянии № 35 (показать схему, формулу, охарактеризовать квантовые числа последнего уровня).

.

3Какие типы химических связей в молекулах ZnO, HCl, O2. (покажите строение молекул при помощи схем).
4.Какую химическую связь называют ковалентной? Чем объясняется направленность ковалентной связи. Объясните строение молекулы воды. Какую ковалентную связь называют сигма.
5.Определить фактор эквивалентности и молярную массу химического эквивалента исходных веществ: ZnOHNO3 + HNO3= Zn(NO3)2 +H2O

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ
Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант 3

1. Какую химическую связь называют ионной, каков механизм ее образования, чем она отличается от ковалентной.
2.Определить валентность в нормальном и возбужденном состоянии № 29 (показать схему, формулу, охарактеризовать квантовые числа ).
3. Какие типы химических связей в молекулах CH4, Cu, Br2. Составьте электронные схемы строения молекул, укажите степени окисления.
4.Определить фактор эквивалентности и молярную массу химического эквивалента исходных веществ: H2SO4 + Zn = ZnSO4 + H2O

5.Донорно-акцепторный механизм образования ковалентной связи (на примере ВF 4)

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант 4

  1. Правило Гунда. Показать на заполнении d-подуровня.


2.Определить валентность в нормальном и возбужденном состоянии № 16 (показать схему, формулу, охарактеризовать квантовые числа последнего энергетического уровня.
3. Какие типы химических связей в молекулах СaCl2, NaI, Br2. Составьте схемы строения молекул.

4.Определить фактор эквивалентности и молярную массу химического эквивалента исходных веществ: H2SO4 + 2 KOH=K2HSO4 + H2Ol

5.Основные законы по химии: эквивалентов, кратных отношений, постоянства состава.(определите эквивалент (NaOH, H2 SO4, H2S).

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство

Вариант 5

1 Поляризуемость ковалентной связи, что называется дипольным моментом, единицы измерения.

2.Определить валентность в нормальном и возбужденном состоянии № 46 (показать схему, формулу, охарактеризовать все квантовые числа ).

3. Сколько литров составляют 2 моля CH4.

4.Определить фактор эквивалентности и молярную массу химического эквивалента исходных веществ: ZnOHNO3 + HNO3 = Zn(NO3)2 + H2O

5. Свойства ковалентной связи. Показать на примерах NH3, NaCl электронные и ионные формулы

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство


Вариант 6
1.Охарактеризуйте квантовые числа n,m,l для электронов в нормальном состоянии.
2.Определите валентность в нормальном и возбужденном состоянии № 31 (показать схему, формулу, охарактеризовать квантовые числа последнего энергетического уровня).
3.Какую химическую связь называют донорно-акцепторной, показать на примере H3О+
4.Докажите угловое строение CH4 (показать схемой)
5.Определите фактор эквивалентности и молярную массу химического эквивалента исходных веществ:

NaHSO4 + NaCl= Na2SO4 + HCl

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство


Вариант 7


  1. Гибридизация связей, типы гибридизации.


2.Определить валентность в нормальном и возбужденном состоянии № 35 (показать схему, формулу, охарактеризовать квантовые числа последнего энергетического уровня).
.

3Какие типы химических связей в молекулах NaF, HCl, O2. (покажите строение молекул при помощи схем).
4. Определить молярную массу химического эквивалента металла, который массой 5 г взаимодействует с соляной кислотой и при этом образуется 5 г водорода.
5.Определить фактор эквивалентности и молярную массу химического эквивалента: ZnOHNO3 + HNO3= Zn(NO3)2 +H2O
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство

Вариант 8

1 (Методом МО) покажите энергетическую схему образования иона He2 +.
2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа ).
3. Какие типы химических связей в молекулах CH4, PH3, Br2,CO. Составьте электронные схемы строения молекул, укажите степени окисления.
4.Определить фактор эквивалентности и молярную массу химического эквивалента: H2SO4 + HNO3 = Zn(NO3)2 + H2O

5.Донорно-акцепторный механизм образования ковалентной связи (на примере ВF 4)

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство

Вариант 9

1.(Методом МО) Покажите энергетическую схему образования иона He2 , возможно ли существование данного иона.
2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа).
3. Какие типы химических связей в молекулах СaCl2, NaI, Br2,CO. Составьте схемы строения молекул.

4.Определить фактор эквивалентности и молярную массу химического эквивалента: H2SO4 + NaCl=NaHSO4 + HCl

5.Основные законы по химии: сохранения массы, эквивалентов, кратных отношений, постоянства состава.(определите эквивалент (NH3, H2O, H2S).

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант 10

1 (методом МО) Покажите энергетическую схему образования иона H2 , H2 + возможно ли существование данного иона.
2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа ).
3. Показать резонансную структуру иона NO3 -

4.Определить фактор эквивалентности и молярную массу химического эквивалента: Fe(OH)2Cl + 2HCl =FeCl3 + 2H2O

5. Определить длину диполя молекулы NH3, если дипольный момент 1,46 дебай.
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство

Вариант 11
1.Покажите (методом МО) энергетическую схему образования молекулы СО, парамагнитными или диамагнитными свойствами она обладает.
2.Определите валентность в нормальном и возбужденном состоянии № 87 (показать схему, формулу, охарактеризовать все квантовые числа ).
3.Определите степень окисления углерода в соединениях CO2, HCOOH,CH3OH
4.Докажите угловое строение H2O, CH4 (показать схемой)
5.Определите фактор эквивалентности и молярную массу химического эквивалента:

NaHSO4 + NaCl= Na2SO4 + HCl

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант12

1.По методу молекулярных орбиталей определите порядок связи в молекуле N2, показать сему молекулы.

2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа ).

3Какие типы химических связей в молекулах ZnO, HCl, O2. (покажите строение молекул при помощи схем).

4Какую химическую связь называют ковалентной? Чем объясняется направленность ковалентной связи. Объясните строение молекулы воды. Какую ковалентную связь называют сигма и пи связью (показать на примере С2H2).

5.Определить фактор эквивалентности и молярную массу химического эквивалента: ZnOHNO3 + HNO3= Zn(NO3)2 +H2O

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство

Вариант 13

1 (Методом МО) покажите энергетическую схему образования иона He2 +.
2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа).
3. Какие типы химических связей в молекулах CH4, PH3, Br2,CO. Составьте электронные схемы строения молекул, укажите степени окисления.
4.Определить фактор эквивалентности и молярную массу химического эквивалента: Zn + HNO3 = Zn(NO3)2 + H2

5.Донорно-акцепторный механизм образования ковалентной связи (на примере ВF 4)

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство
Вариант14

1.(Методом МО) Покажите энергетическую схему образования иона He2 , возможно ли существование данного иона.
2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа ).
3. Какие типы химических связей в молекулах СaCl2, NaI, Br2,CO. Составьте схемы строения молекул.

4.Определить фактор эквивалентности и молярную массу химического эквивалента: H2SO4 + NaCl=NaHSO4 + HCl

5.Основные законы по химии: сохранения массы, эквивалентов, кратных отношений, постоянства состава (определите эквивалент (NH3, H2O, H2S).

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №1

Направление подготовки

111500 Промышленное рыболовство

Вариант1 5

1 (методом МО) Покажите энергетическую схему образования иона H2 , H2 + возможно ли существование данного иона.
2.Определить валентность в нормальном и возбужденном состоянии № 65 (показать схему, формулу, охарактеризовать все квантовые числа ).
3. Показать резонансную структуру иона NO3 -

4.Определить фактор эквивалентности и молярную массу химического эквивалента: Fe(OH)2Cl + 2HCl =FeCl3 + 2H2O

5. Определить длину диполя молекулы NH3, если дипольный момент 1,46 дебай.
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство
Вариант 1
1.К 250 мл 0,1 н раствора серной кислоты прибавили 200 мл воды, рассчитайте нормальность полученного раствора.

2. Гидролиз раствора CuCI2 .

3.Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 27

4. Уравнять методом электронного баланса:

KMnO4 + KNO2 + H2SO4 → MnSO4 + KNO3 + K2SO4+ H2O

5 Написать молекулярное, полное ионное и сокращенное ионное уравнение ZnCl2 + NaOH =

6. Определить .Мэкв. сульфата натрия, гидрооксида алюминия, карбоната кальция.

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство
Вариант 2

1.К 200 г 5 % раствора NaCl добавили 200 г воды. Рассчитайте массовую долю соли в % полученного раствора.

2.Гидролиз соли Na2S. Указать среду раствора.

3. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 32

4.Уравнять методом электронного баланса:

KMnO4 + K2SO3 + H2O → MnO2 + K2SO4 + KOH

Какой из элементов является окислителем, какой восстановителем?

5.Написать молекулярное, полное ионное и сокращенное ионное уравнение ZnCl2 + Na2S =

6. Определить .Мэкв. сульфита натрия, гидрооксида бария, карбоната калия

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство
Вариант3

1.Найти молярную и нормальную концентрации 15 % (по массе) раствора H2SO4 ( р=1,10 г/мл)

2. Гидролиз раствора NiSO4 , указать среду раствора.

3. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 37

4.Уравнять методом электронного баланса:

KМnO4 + KNO2 + KOH → K2MnO4 + KNO3 + H2O

Какой из элементов является окислителем, какой восстановителем?

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AlCl3 + NaOH =

6. Определить .Мэкв. сульфида натрия, гидрооксида калия, ортофосфорной кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство
Вариант 4

1.К 300 г 5% раствора NaCl добавили 200 г 2 % раствора NaCl. Рассчитайте молярную, если плотность равна 1,1 г/мл.

2.Гидролиз раствора AlСI3, указать среду раствора.

3.Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 33

4.Уравнять методом электронного баланса:H2SO3 +H2S= S+H2O

Какой из элементов является окислителем, какой восстановителем?

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение Na2CO3 + HCl =

6. Определить .Мэкв. сульфида кальция, гидрооксида кальция, сернистой кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство
Вариант 5

1. К 200 г 6 % NaCl добавили 200 г воды, плотность 1,1 г/мл. Рассчитайте молярную, процентную концентрации полученного раствора.

2. Гидролиз солей Na2 SO3, указать среду раствора

3.Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 35

4.Уравнять методом электронного баланса:

Cl2 +KOH=KCl +H2O +KClO3 Какой из элементов является окислителем, какой восстановителем?

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение BaCl2 + H2SO4 =

6. Определить .Мэкв. сульфида натрия, гидрооксида калия, ортофосфорной кислоты

Разработал

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 6

1.Рассчитать нормальную концентрации карбоната калия, если массовая доля равна 11,3 %, плотность раствора равна 0,9г/см3.

2. Гидролиз солей СиSO4, указать среду раствора

3.Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 24

4.Уравнять методом электронного баланса: Сu + HNO3=Cu(NO3)2+NO2+H2O

Какой из элементов является окислителем, какой восстановителем?

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение

6. Определить .Мэкв. сульфида калия, гидрооксида аммония, ортофосфорной кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 7

1.Рассчитайте молярную концентрацию раствора, полученного при смешивании 200 мл 10% раствора и 150мл 5% раствора серной кислоты.

2. Гидролиз солей Na2S указать среду раствора

3.Уравнять методом электронного баланса:

Zn + H2SO4=ZnSO4+SO2 +H2O

Какой из элементов является окислителем, какой восстановителем?

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 38

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AgNO3 + Na3PO4

6. Определить .Мэкв. сульфита натрия, гидрооксида калия, ортофосфорной кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 9

1.К 300 мл воды добавили 30 г буры (Na 2B 4O 7). Рассчитать процентную, молярную концентрации полученного раствора, если плотность равна 0,6 г/см3.

  1. Гидролиз SnCI2 , указать среду раствора, рН.

3. .Уравнять методом электронного баланса:

KClO3=KCl+O2

Какой из элементов является окислителем, какой восстановителем?

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 37

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AlCl3 + NaOH =

6. Опредкелить .Мэкв. сульфида натрия, гидрооксида калия, ортофосфорной кислоты
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 10

1.К 200 г. 5 % раствора NaCI добавили 200 г воды. Рассчитать массовую долю и молярность полученного раствора.

2.Гидролиз: ZnCI2. Записать уравнения, определить рН растворов

3.Уравнять методом электронного баланса:

H2O2 +KI +H2SO4= K2SO4+I2+H2O

Какой из элементов является окислителем, какой восстановителем?

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 34

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AlCl3 + NaOH =

6. Определить .Мэкв. силиката натрия, гидрооксида свинца, сероводородной кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 11

1.Сколько граммов Na2SO3 потребуется для приготовления 5 л 2 М раствора.

2.Гидролиз: Na3PO4. Записать уравнения, определить рН растворов

3.Уравнять методом электронного баланса:

Na2O2 +CO2= Na2CO3+O2

Какой из элементов является окислителем, какой восстановителем?

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 38

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AgNO3 + К3PO4

6. Определить .Мэкв. нитрата натрия, гидрооксида алюминия, соляной кислоты
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 13

1.Найти молярность 50 г 36 % раствора HCI, при р = 1,18 г/мл.

если изделие из цинка покрыто барием

2.Гидролиз Na2SO3 указать среду раствора, рН.

3.Уравнять методом электронного баланса:

CuS+HNO3=Cu(NO3)2+H2SO4+NO2+H2O

Какой из элементов является окислителем, какой восстановителем?

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 38

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение NH4Cl + NaOH

6. Определить .Мэкв. карбоната натрия, гидрооксида бария, серной кислоты
Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

111500 Промышленное рыболовство

Вариант 14

  1. Рассчитать нормальную концентрацию и титр 20% раствора H2SO4, массой 150 г плотность которого 1,1 г/см3

  2. Гидролиз раствора CuSO4 , указать среду раствора

3.Уравнять методом электронного баланса, определить окислитель и восстановитель:

I2 + HNO3 = HIO3 + NO2 + H2O

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 29

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AgNO3 + Na3PO4

6. Определить .Мэкв. сульфита натрия, гидрооксида калия, ортофосфорной кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство

Вариант 14

  1. Рассчитать нормальную концентрацию и титр 20% раствора H2SO4, массой 150 г плотность которого 1,1 г/см3

  2. Гидролиз раствора CuSO4 , указать среду раствора

3.Уравнять методом электронного баланса, определить окислитель и восстановитель:

I2 + HNO3 = HIO3 + NO2 + H2O

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 29

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение AgNO3 + Na3PO4

6. Определить .Мэкв. сульфита натрия, гидрооксида калия, ортофосфорной кислоты

Федеральное государственное образовательное учреждение высшего профессионального образования

«Калининградский государственный технический университет»

Факультет ФФП

Дисциплина ЕН.Ф.04.ХИМИЯ

Коллоквиум №2

Направление подготовки

111500 Промышленное рыболовство


Вариант 13

1.Найти молярность 50 г 36 % раствора HCI, при р = 1,18 г/мл.

если изделие из цинка покрыто барием

2.Гидролиз Na2SO3 указать среду раствора, рН.

3.Уравнять методом электронного баланса:

CuS+HNO3=Cu(NO3)2+H2SO4+NO2+H2O

Какой из элементов является окислителем, какой восстановителем?

4. Написать электронную формулу, определить валентность в нормальном и возбужденном состоянии № 38

5. Написать молекулярное, полное ионное и сокращенное ионное уравнение NH4Cl + NaOH

6. Определить .Мэкв. карбоната натрия, гидрооксида бария, серной кислоты